CAS 1420875-79-1 is the registry number for 2-Nitro-N-(trifluoromethyl)benzenemethanamine. Offered by: TRC. Available pack sizes: 100mg.
1,1,1-trifluoro-N-[(2-nitrophenyl)methyl]methanamine (CAS 1420875-79-1) is a chemical compound with the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. IUPAC name: 1,1,1-trifluoro-N-[(2-nitrophenyl)methyl]methanamine. InChIKey: JKBNIDJOTPHYDO-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O2 |
|---|---|
| Molecular weight | 220.15 g/mol |
| IUPAC name | 1,1,1-trifluoro-N-[(2-nitrophenyl)methyl]methanamine |
| InChIKey | JKBNIDJOTPHYDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)