CAS 142121-93-5 is the registry number for 2–((tert–Butoxycarbonyl)amino)–2–(4–fluorophenyl)acetic acid. Offered by: GLPBio. Available pack sizes: 1g, 5g.
2-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 142121-93-5) is a chemical compound with the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. IUPAC name: 2-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: IEQBOUSLFRLKKX-UHFFFAOYSA-N.
| Molecular formula | C13H16FNO4 |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | IEQBOUSLFRLKKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)