Products 658085-43-9

CAS 658085-43-9 is the registry number for 5-tert-Butoxycarbonylamino-4-fluoro-2-methyl-benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-fluoro-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 658085-43-9) is a chemical compound with the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. IUPAC name: 4-fluoro-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: SGTSRFWTQFTHFU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16FNO4
Molecular weight269.27 g/mol
IUPAC name4-fluoro-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid
InChIKeySGTSRFWTQFTHFU-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1C(=O)O)NC(=O)OC(C)(C)C)F

Computed by PubChem (NCBI)