CAS 142186-36-5 appears in our catalog under these names: (S)–2–((tert–Butoxycarbonyl)amino)–2–(4–fluorophenyl)acetic acid, Boc-4-F-Phg-OH 95%, (S)-2-((tert-Butoxycarbonyl)amino)-2-(4-fluorophenyl)acetic acid, 95%, 95%, (S)-2-((tert-Butoxycarbonyl)amino)-2-(4-fluorophenyl)acetic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
(2S)-2-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 142186-36-5) is a chemical compound with the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. IUPAC name: (2S)-2-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: IEQBOUSLFRLKKX-JTQLQIEISA-N.
| Molecular formula | C13H16FNO4 |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | (2S)-2-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | IEQBOUSLFRLKKX-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)