CAS 1421261-89-3 is the registry number for 2-(Thiophen-2-yl)-1H-1,3-benzodiazole-6-carbonitrile. Offered by: Biosynth. Available pack sizes: 1g, 10g.
2-thiophen-2-yl-3H-benzimidazole-5-carbonitrile (CAS 1421261-89-3) is a chemical compound with the molecular formula C12H7N3S and a molecular weight of 225.27 g/mol. IUPAC name: 2-thiophen-2-yl-3H-benzimidazole-5-carbonitrile. InChIKey: CKWJNCCUXIRAOO-UHFFFAOYSA-N.
| Molecular formula | C12H7N3S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | 2-thiophen-2-yl-3H-benzimidazole-5-carbonitrile |
| InChIKey | CKWJNCCUXIRAOO-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC3=C(N2)C=C(C=C3)C#N |
Computed by PubChem (NCBI)