CAS 1549852-11-0 appears in our catalog under these names: 2-(Thiophen-3-yl)-1H-1,3-benzodiazole-5-carbonitrile, 95%, 2-(Thiophen-3-yl)-1H-1,3-benzodiazole-5-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-thiophen-3-yl-3H-benzimidazole-5-carbonitrile (CAS 1549852-11-0) is a chemical compound with the molecular formula C12H7N3S and a molecular weight of 225.27 g/mol. IUPAC name: 2-thiophen-3-yl-3H-benzimidazole-5-carbonitrile. InChIKey: PAPMVWGWFOUEMD-UHFFFAOYSA-N.
| Molecular formula | C12H7N3S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | 2-thiophen-3-yl-3H-benzimidazole-5-carbonitrile |
| InChIKey | PAPMVWGWFOUEMD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)NC(=N2)C3=CSC=C3 |
Computed by PubChem (NCBI)