CAS 528522-91-0 appears in our catalog under these names: 4-(2-(Cyanomethyl)-1,3-thiazol-4-yl)benzonitrile, 95%, 4-(2-(Cyanomethyl)-1,3-thiazol-4-yl)benzonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-[2-(cyanomethyl)-1,3-thiazol-4-yl]benzonitrile (CAS 528522-91-0) is a chemical compound with the molecular formula C12H7N3S and a molecular weight of 225.27 g/mol. IUPAC name: 4-[2-(cyanomethyl)-1,3-thiazol-4-yl]benzonitrile. InChIKey: SVCITPHNDXGZOF-UHFFFAOYSA-N.
| Molecular formula | C12H7N3S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | 4-[2-(cyanomethyl)-1,3-thiazol-4-yl]benzonitrile |
| InChIKey | SVCITPHNDXGZOF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CSC(=N2)CC#N |
Computed by PubChem (NCBI)