CAS 1421313-95-2 appears in our catalog under these names: 5-Fluoro-3-(trifluoromethyl)picolinonitrile, 95%, 95%, 5-Fluoro-3-(trifluoromethyl)picolinonitrile 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-fluoro-3-(trifluoromethyl)pyridine-2-carbonitrile (CAS 1421313-95-2) is a chemical compound with the molecular formula C7H2F4N2 and a molecular weight of 190.10 g/mol. IUPAC name: 5-fluoro-3-(trifluoromethyl)pyridine-2-carbonitrile. InChIKey: COQZJFJCFXHKLO-UHFFFAOYSA-N.
| Molecular formula | C7H2F4N2 |
|---|---|
| Molecular weight | 190.10 g/mol |
| IUPAC name | 5-fluoro-3-(trifluoromethyl)pyridine-2-carbonitrile |
| InChIKey | COQZJFJCFXHKLO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)C#N)F |
Computed by PubChem (NCBI)