Products 1805462-16-1
CAS 1805462-16-1 is the registry number for 4-Fluoro-6-(trifluoromethyl)nicotinonitrile, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-6-(trifluoromethyl)pyridine-3-carbonitrile (CAS 1805462-16-1) is a chemical compound with the molecular formula C7H2F4N2 and a molecular weight of 190.10 g/mol. IUPAC name: 4-fluoro-6-(trifluoromethyl)pyridine-3-carbonitrile. InChIKey: LJTRLUPNZSNQMQ-UHFFFAOYSA-N.
| Molecular formula | C7H2F4N2 |
|---|---|
| Molecular weight | 190.10 g/mol |
| IUPAC name | 4-fluoro-6-(trifluoromethyl)pyridine-3-carbonitrile |
| InChIKey | LJTRLUPNZSNQMQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)C#N)F |
Computed by PubChem (NCBI)