Products 1807303-10-1
CAS 1807303-10-1 is the registry number for 5-Fluoro-6-(trifluoromethyl)nicotinonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
5-fluoro-6-(trifluoromethyl)pyridine-3-carbonitrile (CAS 1807303-10-1) is a chemical compound with the molecular formula C7H2F4N2 and a molecular weight of 190.10 g/mol. IUPAC name: 5-fluoro-6-(trifluoromethyl)pyridine-3-carbonitrile. InChIKey: HSJJRYVCFVSJAZ-UHFFFAOYSA-N.
| Molecular formula | C7H2F4N2 |
|---|---|
| Molecular weight | 190.10 g/mol |
| IUPAC name | 5-fluoro-6-(trifluoromethyl)pyridine-3-carbonitrile |
| InChIKey | HSJJRYVCFVSJAZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)C(F)(F)F)C#N |
Computed by PubChem (NCBI)