CAS 142141-07-9 is the registry number for Isothiazolo(5,4-c)pyridin-3(2H)-one 1,1-dioxide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1,1-dioxo-[1,2]thiazolo[5,4-c]pyridin-3-one (CAS 142141-07-9) is a chemical compound with the molecular formula C6H4N2O3S and a molecular weight of 184.17 g/mol. IUPAC name: 1,1-dioxo-[1,2]thiazolo[5,4-c]pyridin-3-one. InChIKey: OCDUJMWEISRJAC-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O3S |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | 1,1-dioxo-[1,2]thiazolo[5,4-c]pyridin-3-one |
| InChIKey | OCDUJMWEISRJAC-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=O)NS2(=O)=O |
Computed by PubChem (NCBI)