CAS 53229-49-5 is the registry number for 3-Hydroxythieno[2,3-d]pyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione (CAS 53229-49-5) is a chemical compound with the molecular formula C6H4N2O3S and a molecular weight of 184.17 g/mol. IUPAC name: 3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione. InChIKey: NNWNTVVLCCOLEQ-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O3S |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | 3-hydroxy-1H-thieno[2,3-d]pyrimidine-2,4-dione |
| InChIKey | NNWNTVVLCCOLEQ-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=O)N(C(=O)N2)O |
Computed by PubChem (NCBI)