CAS 1629319-51-2 is the registry number for 2H,3H-1Lambda6-(1,2)thiazolo(4,5-b)pyridine-1,1,3-trione, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1,1-dioxo-[1,2]thiazolo[4,5-b]pyridin-3-one (CAS 1629319-51-2) is a chemical compound with the molecular formula C6H4N2O3S and a molecular weight of 184.17 g/mol. IUPAC name: 1,1-dioxo-[1,2]thiazolo[4,5-b]pyridin-3-one. InChIKey: QSASMMZWKKZWNJ-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O3S |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | 1,1-dioxo-[1,2]thiazolo[4,5-b]pyridin-3-one |
| InChIKey | QSASMMZWKKZWNJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)NS2(=O)=O)N=C1 |
Computed by PubChem (NCBI)