CAS 1421601-62-8 is the registry number for 2-Bromo-4-methyl-1,3-thiazole-5-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-bromo-4-methyl-1,3-thiazole-5-sulfonyl chloride (CAS 1421601-62-8) is a chemical compound with the molecular formula C4H3BrClNO2S2 and a molecular weight of 276.6 g/mol. IUPAC name: 2-bromo-4-methyl-1,3-thiazole-5-sulfonyl chloride. InChIKey: JAMLMXDGTIYZMH-UHFFFAOYSA-N.
| Molecular formula | C4H3BrClNO2S2 |
|---|---|
| Molecular weight | 276.6 g/mol |
| IUPAC name | 2-bromo-4-methyl-1,3-thiazole-5-sulfonyl chloride |
| InChIKey | JAMLMXDGTIYZMH-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)