CAS 2090710-30-6 is the registry number for 2-Bromo-5-methyl-1,3-thiazole-4-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-bromo-5-methyl-1,3-thiazole-4-sulfonyl chloride (CAS 2090710-30-6) is a chemical compound with the molecular formula C4H3BrClNO2S2 and a molecular weight of 276.6 g/mol. IUPAC name: 2-bromo-5-methyl-1,3-thiazole-4-sulfonyl chloride. InChIKey: LWMYESNUDKBXJB-UHFFFAOYSA-N.
| Molecular formula | C4H3BrClNO2S2 |
|---|---|
| Molecular weight | 276.6 g/mol |
| IUPAC name | 2-bromo-5-methyl-1,3-thiazole-4-sulfonyl chloride |
| InChIKey | LWMYESNUDKBXJB-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)