CAS 77893-75-5 appears in our catalog under these names: 5-Bromo-4-chlorothiophene-2-sulfonamide, 5-Bromo-4-chlorothiophene-2-sulfonamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
5-bromo-4-chlorothiophene-2-sulfonamide (CAS 77893-75-5) is a chemical compound with the molecular formula C4H3BrClNO2S2 and a molecular weight of 276.6 g/mol. IUPAC name: 5-bromo-4-chlorothiophene-2-sulfonamide. InChIKey: PRKDIXNPZQMOAL-UHFFFAOYSA-N.
| Molecular formula | C4H3BrClNO2S2 |
|---|---|
| Molecular weight | 276.6 g/mol |
| IUPAC name | 5-bromo-4-chlorothiophene-2-sulfonamide |
| InChIKey | PRKDIXNPZQMOAL-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1Cl)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)