CAS 1421789-04-9 appears in our catalog under these names: 9,9'-spirobi(fluoren)-6-ylboronic acid9,9'-spirobi(fluoren)-6-ylboronic acid, >98% (HPLC), 9,9'–Spirobi(fluoren)–3–ylboronic acid. Offered by: Lumtec, GLPBio. Available pack sizes: On request, 10g.
9,9'-spirobi[fluorene]-3-ylboronic acid (CAS 1421789-04-9) is a chemical compound with the molecular formula C25H17BO2 and a molecular weight of 360.2 g/mol. IUPAC name: 9,9'-spirobi[fluorene]-3-ylboronic acid. InChIKey: RDUYDKNCVPJOAG-UHFFFAOYSA-N.
| Molecular formula | C25H17BO2 |
|---|---|
| Molecular weight | 360.2 g/mol |
| IUPAC name | 9,9'-spirobi[fluorene]-3-ylboronic acid |
| InChIKey | RDUYDKNCVPJOAG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C3(C4=CC=CC=C4C5=CC=CC=C53)C6=CC=CC=C62)(O)O |
Computed by PubChem (NCBI)