CAS 1421789-05-0 is the registry number for 9,9'-spirobi(fluorene)-4-ylboronic acid9,9'-spirobi(fluorene)-4-ylboronic acid, >98%. Offered by: Lumtec. Available pack sizes: On request.
9,9'-spirobi[fluorene]-4'-ylboronic acid (CAS 1421789-05-0) is a chemical compound with the molecular formula C25H17BO2 and a molecular weight of 360.2 g/mol. IUPAC name: 9,9'-spirobi[fluorene]-4'-ylboronic acid. InChIKey: NOTKALFQBCUAKB-UHFFFAOYSA-N.
| Molecular formula | C25H17BO2 |
|---|---|
| Molecular weight | 360.2 g/mol |
| IUPAC name | 9,9'-spirobi[fluorene]-4'-ylboronic acid |
| InChIKey | NOTKALFQBCUAKB-UHFFFAOYSA-N |
| SMILES | B(C1=C2C3=CC=CC=C3C4(C2=CC=C1)C5=CC=CC=C5C6=CC=CC=C46)(O)O |
Computed by PubChem (NCBI)