Products 1561044-65-2

CAS 1561044-65-2 is the registry number for 9,9'-Spirobi[fluoren]-1-ylboronic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

9,9'-spirobi[fluorene]-1'-ylboronic acid (CAS 1561044-65-2) is a chemical compound with the molecular formula C25H17BO2 and a molecular weight of 360.2 g/mol. IUPAC name: 9,9'-spirobi[fluorene]-1'-ylboronic acid. InChIKey: LQRJHFQPMJHZRI-UHFFFAOYSA-N.

Identity
Molecular formulaC25H17BO2
Molecular weight360.2 g/mol
IUPAC name9,9'-spirobi[fluorene]-1'-ylboronic acid
InChIKeyLQRJHFQPMJHZRI-UHFFFAOYSA-N
SMILESB(C1=C2C(=CC=C1)C3=CC=CC=C3C24C5=CC=CC=C5C6=CC=CC=C46)(O)O

Computed by PubChem (NCBI)