CAS 142189-87-5 is the registry number for (2R-cis)-5-[Tetrahydro-5-(hydroxymethyl)-4-oxo-2-furanyl]-2,4(1H,3H)-pyrimidinedione. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(2R,5R)-5-(hydroxymethyl)-4-oxooxolan-2-yl]-1H-pyrimidine-2,4-dione (CAS 142189-87-5) is a chemical compound with the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. IUPAC name: 5-[(2R,5R)-5-(hydroxymethyl)-4-oxooxolan-2-yl]-1H-pyrimidine-2,4-dione. InChIKey: XNNRBPBGCPXKGR-RNFRBKRXSA-N.
| Molecular formula | C9H10N2O5 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | 5-[(2R,5R)-5-(hydroxymethyl)-4-oxooxolan-2-yl]-1H-pyrimidine-2,4-dione |
| InChIKey | XNNRBPBGCPXKGR-RNFRBKRXSA-N |
| SMILES | C1[C@@H](O[C@@H](C1=O)CO)C2=CNC(=O)NC2=O |
Computed by PubChem (NCBI)