Products 1422007-49-5
CAS 1422007-49-5 appears in our catalog under these names: Ivabradine Impurity 62, (R)-(3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-trien-7-yl)methanamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(7R)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]methanamine (CAS 1422007-49-5) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: [(7R)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]methanamine. InChIKey: JDZSBHBIJDIACW-QMMMGPOBSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | [(7R)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]methanamine |
| InChIKey | JDZSBHBIJDIACW-QMMMGPOBSA-N |
| SMILES | COC1=C(C=C2[C@@H](CC2=C1)CN)OC |
Computed by PubChem (NCBI)