CAS 1422344-51-1 is the registry number for tert-Butyl (3aS,9bR)-1H,3H,3aH,4H,5H,9bH-pyrrolo[3,4-c]quinoline-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl (3aS,9bR)-1,3,3a,4,5,9b-hexahydropyrrolo[3,4-c]quinoline-2-carboxylate (CAS 1422344-51-1) is a chemical compound with the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. IUPAC name: tert-butyl (3aS,9bR)-1,3,3a,4,5,9b-hexahydropyrrolo[3,4-c]quinoline-2-carboxylate. InChIKey: UKODSGDGRCDPPY-WCQYABFASA-N.
| Molecular formula | C16H22N2O2 |
|---|---|
| Molecular weight | 274.36 g/mol |
| IUPAC name | tert-butyl (3aS,9bR)-1,3,3a,4,5,9b-hexahydropyrrolo[3,4-c]quinoline-2-carboxylate |
| InChIKey | UKODSGDGRCDPPY-WCQYABFASA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CNC3=CC=CC=C3[C@@H]2C1 |
Computed by PubChem (NCBI)