Products 1807453-44-6

CAS 1807453-44-6 is the registry number for EGFR-IN-122, 99.98%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 5 mg, 100 mg, 25 mg.

Structural formula: {0} (CAS {1})

4-N-(2,5-dimethoxyphenyl)-6-N-(3-methoxyphenyl)pyrimidine-4,6-diamine (CAS 1807453-44-6) is a chemical compound with the molecular formula C19H20N4O3 and a molecular weight of 352.4 g/mol. IUPAC name: 4-N-(2,5-dimethoxyphenyl)-6-N-(3-methoxyphenyl)pyrimidine-4,6-diamine. InChIKey: QIAHWAXXEKSCCE-UHFFFAOYSA-N.

Identity
Molecular formulaC19H20N4O3
Molecular weight352.4 g/mol
IUPAC name4-N-(2,5-dimethoxyphenyl)-6-N-(3-methoxyphenyl)pyrimidine-4,6-diamine
InChIKeyQIAHWAXXEKSCCE-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)OC)NC2=NC=NC(=C2)NC3=CC(=CC=C3)OC

Computed by PubChem (NCBI)