Products 142266-65-7

CAS 142266-65-7 is the registry number for 2-Chloro-4-hydroxynicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-chloro-4-oxo-1H-pyridine-3-carboxylic acid (CAS 142266-65-7) is a chemical compound with the molecular formula C6H4ClNO3 and a molecular weight of 173.55 g/mol. IUPAC name: 2-chloro-4-oxo-1H-pyridine-3-carboxylic acid. InChIKey: ITOJWSATFMNOEQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4ClNO3
Molecular weight173.55 g/mol
IUPAC name2-chloro-4-oxo-1H-pyridine-3-carboxylic acid
InChIKeyITOJWSATFMNOEQ-UHFFFAOYSA-N
SMILESC1=CNC(=C(C1=O)C(=O)O)Cl

Computed by PubChem (NCBI)