CAS 1423024-65-0 appears in our catalog under these names: 4-Bromo-2-(1-methylethyl)-6-nitro-benzenamine, 4-Bromo-2-nitro-6-(propan-2-yl)aniline. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 100mg, 1g.
4-bromo-2-nitro-6-propan-2-ylaniline (CAS 1423024-65-0) is a chemical compound with the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. IUPAC name: 4-bromo-2-nitro-6-propan-2-ylaniline. InChIKey: PLQCPZLZGMHBKD-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 4-bromo-2-nitro-6-propan-2-ylaniline |
| InChIKey | PLQCPZLZGMHBKD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC(=C1)Br)[N+](=O)[O-])N |
Computed by PubChem (NCBI)