CAS 1423026-00-9 appears in our catalog under these names: 2-(1,5-Dimethyl-1H-pyrrol-2-yl)-1,3-thiazole-4-carboxylic acid, 95%, 2-(1,5-Dimethyl-1H-pyrrol-2-yl)-1,3-thiazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(1,5-dimethylpyrrol-2-yl)-1,3-thiazole-4-carboxylic acid (CAS 1423026-00-9) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: 2-(1,5-dimethylpyrrol-2-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: OMVBWGOVOFYKNC-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | 2-(1,5-dimethylpyrrol-2-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | OMVBWGOVOFYKNC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)