CAS 1423026-17-8 appears in our catalog under these names: 7-Amino-3-methyl-2,3-dihydro-1,3-benzoxazol-2-one hydrochloride, 95%, 7-Amino-3-methyl-2,3-dihydro-1,3-benzoxazol-2-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-amino-3-methyl-1,3-benzoxazol-2-one;hydrochloride (CAS 1423026-17-8) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 7-amino-3-methyl-1,3-benzoxazol-2-one;hydrochloride. InChIKey: JDYVKIGGWJNNJA-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 7-amino-3-methyl-1,3-benzoxazol-2-one;hydrochloride |
| InChIKey | JDYVKIGGWJNNJA-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC(=C2OC1=O)N.Cl |
Computed by PubChem (NCBI)