CAS 1423028-30-1 appears in our catalog under these names: Methyl 4-chloro-2,6-dimethylpyridine-3-carboxylate, 95%, Methyl 4-chloro-2,6-dimethylpyridine-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 4-chloro-2,6-dimethylpyridine-3-carboxylate (CAS 1423028-30-1) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: methyl 4-chloro-2,6-dimethylpyridine-3-carboxylate. InChIKey: URFRUCMLMMXZFQ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | methyl 4-chloro-2,6-dimethylpyridine-3-carboxylate |
| InChIKey | URFRUCMLMMXZFQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=N1)C)C(=O)OC)Cl |
Computed by PubChem (NCBI)