CAS 1423029-12-2 is the registry number for 1,1-Dimethyl-3-oxo-2,3-dihydro-1H-indene-5-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1,1-dimethyl-3-oxo-2H-indene-5-sulfonyl chloride (CAS 1423029-12-2) is a chemical compound with the molecular formula C11H11ClO3S and a molecular weight of 258.72 g/mol. IUPAC name: 1,1-dimethyl-3-oxo-2H-indene-5-sulfonyl chloride. InChIKey: GFMLQEKFHGEHQQ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO3S |
|---|---|
| Molecular weight | 258.72 g/mol |
| IUPAC name | 1,1-dimethyl-3-oxo-2H-indene-5-sulfonyl chloride |
| InChIKey | GFMLQEKFHGEHQQ-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C1C=CC(=C2)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)