Products 1461713-93-8

CAS 1461713-93-8 appears in our catalog under these names: 7-Methoxy-3,4-dihydronaphthalene-2-sulfonyl chloride, 95%, 7-Methoxy-3,4-dihydronaphthalene-2-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

7-methoxy-3,4-dihydronaphthalene-2-sulfonyl chloride (CAS 1461713-93-8) is a chemical compound with the molecular formula C11H11ClO3S and a molecular weight of 258.72 g/mol. IUPAC name: 7-methoxy-3,4-dihydronaphthalene-2-sulfonyl chloride. InChIKey: CRHZCIOFWUZRAK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClO3S
Molecular weight258.72 g/mol
IUPAC name7-methoxy-3,4-dihydronaphthalene-2-sulfonyl chloride
InChIKeyCRHZCIOFWUZRAK-UHFFFAOYSA-N
SMILESCOC1=CC2=C(CCC(=C2)S(=O)(=O)Cl)C=C1

Computed by PubChem (NCBI)