Products 1864058-20-7

CAS 1864058-20-7 appears in our catalog under these names: 6-Methoxy-3,4-dihydronaphthalene-2-sulfonyl chloride, 95%, 6-Methoxy-3,4-dihydronaphthalene-2-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.

6-methoxy-3,4-dihydronaphthalene-2-sulfonyl chloride (CAS 1864058-20-7) is a chemical compound with the molecular formula C11H11ClO3S and a molecular weight of 258.72 g/mol. IUPAC name: 6-methoxy-3,4-dihydronaphthalene-2-sulfonyl chloride. InChIKey: PBVIDHLUQCDCFF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClO3S
Molecular weight258.72 g/mol
IUPAC name6-methoxy-3,4-dihydronaphthalene-2-sulfonyl chloride
InChIKeyPBVIDHLUQCDCFF-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)C=C(CC2)S(=O)(=O)Cl

Computed by PubChem (NCBI)