CAS 1423031-17-7 is the registry number for 3-(Phenoxymethyl)-5-(trichloromethyl)-1,2,4-oxadiazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(phenoxymethyl)-5-(trichloromethyl)-1,2,4-oxadiazole (CAS 1423031-17-7) is a chemical compound with the molecular formula C10H7Cl3N2O2 and a molecular weight of 293.5 g/mol. IUPAC name: 3-(phenoxymethyl)-5-(trichloromethyl)-1,2,4-oxadiazole. InChIKey: QUXWYBZOLFPHAQ-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl3N2O2 |
|---|---|
| Molecular weight | 293.5 g/mol |
| IUPAC name | 3-(phenoxymethyl)-5-(trichloromethyl)-1,2,4-oxadiazole |
| InChIKey | QUXWYBZOLFPHAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=NOC(=N2)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)