Products 1803601-01-5

CAS 1803601-01-5 is the registry number for 1-(3,4-Dichlorophenyl)-1H-imidazole-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

1-(3,4-dichlorophenyl)imidazole-4-carboxylic acid;hydrochloride (CAS 1803601-01-5) is a chemical compound with the molecular formula C10H7Cl3N2O2 and a molecular weight of 293.5 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)imidazole-4-carboxylic acid;hydrochloride. InChIKey: SXQWHRNJWNJJEN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7Cl3N2O2
Molecular weight293.5 g/mol
IUPAC name1-(3,4-dichlorophenyl)imidazole-4-carboxylic acid;hydrochloride
InChIKeySXQWHRNJWNJJEN-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1N2C=C(N=C2)C(=O)O)Cl)Cl.Cl

Computed by PubChem (NCBI)