CAS 263386-10-3 is the registry number for 5-Chloromethyl-3-(3,4-dichloro-phenoxymethyl)-[1,2,4]oxadiazole. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g.
5-(chloromethyl)-3-[(3,4-dichlorophenoxy)methyl]-1,2,4-oxadiazole (CAS 263386-10-3) is a chemical compound with the molecular formula C10H7Cl3N2O2 and a molecular weight of 293.5 g/mol. IUPAC name: 5-(chloromethyl)-3-[(3,4-dichlorophenoxy)methyl]-1,2,4-oxadiazole. InChIKey: DJCNKUFLGYKHED-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl3N2O2 |
|---|---|
| Molecular weight | 293.5 g/mol |
| IUPAC name | 5-(chloromethyl)-3-[(3,4-dichlorophenoxy)methyl]-1,2,4-oxadiazole |
| InChIKey | DJCNKUFLGYKHED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC2=NOC(=N2)CCl)Cl)Cl |
Computed by PubChem (NCBI)