CAS 6293-87-4 appears in our catalog under these names: 2-Nitrophenylhydrazine Hydrochloride, 2-Nitrophenylhydrazine Hydrochloride, >98.0%(HPLC)(T), (2-Nitrophenyl)hydrazine hydrochloride 98%, (2-Nitrophenyl)hydrazine hydrochloride, 98%, 98%, 2-Nitrophenylhydrazine hydrochloride, 95%. Offered by: Chemat Brand, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 25g, 50g, 100g, 500g, 1g, 10g, 5g.
(2-nitrophenyl)hydrazine;hydrochloride (CAS 6293-87-4) is a chemical compound with the molecular formula C6H8ClN3O2 and a molecular weight of 189.60 g/mol. IUPAC name: (2-nitrophenyl)hydrazine;hydrochloride. InChIKey: XCUBVSAYUSFHNN-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN3O2 |
|---|---|
| Molecular weight | 189.60 g/mol |
| IUPAC name | (2-nitrophenyl)hydrazine;hydrochloride |
| InChIKey | XCUBVSAYUSFHNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NN)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)