CAS 1423031-69-9 appears in our catalog under these names: 2-(2-Amino-2-methylbutoxy)-3-chloropyridine hydrochloride, 98%, 2-(2-Amino-2-methylbutoxy)-3-chloropyridine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 50mg, 0,5g.
1-[(3-chloro-2-pyridinyl)oxy]-2-methylbutan-2-amine;hydrochloride (CAS 1423031-69-9) is a chemical compound with the molecular formula C10H16Cl2N2O and a molecular weight of 251.15 g/mol. IUPAC name: 1-[(3-chloro-2-pyridinyl)oxy]-2-methylbutan-2-amine;hydrochloride. InChIKey: JEUOMKJHDVGTIO-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2O |
|---|---|
| Molecular weight | 251.15 g/mol |
| IUPAC name | 1-[(3-chloro-2-pyridinyl)oxy]-2-methylbutan-2-amine;hydrochloride |
| InChIKey | JEUOMKJHDVGTIO-UHFFFAOYSA-N |
| SMILES | CCC(C)(COC1=C(C=CC=N1)Cl)N.Cl |
Computed by PubChem (NCBI)