Products 1423031-79-1

CAS 1423031-79-1 is the registry number for 4-(Chlorosulfonyl)-2-(trifluoromethyl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

4-chlorosulfonyl-2-(trifluoromethyl)benzoic acid (CAS 1423031-79-1) is a chemical compound with the molecular formula C8H4ClF3O4S and a molecular weight of 288.63 g/mol. IUPAC name: 4-chlorosulfonyl-2-(trifluoromethyl)benzoic acid. InChIKey: XLFHWFRZFVYVOF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4ClF3O4S
Molecular weight288.63 g/mol
IUPAC name4-chlorosulfonyl-2-(trifluoromethyl)benzoic acid
InChIKeyXLFHWFRZFVYVOF-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)Cl)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)