CAS 2137649-82-0 is the registry number for Methyl 5-(chlorosulfonyl)-2,3,4-trifluorobenzoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 5-chlorosulfonyl-2,3,4-trifluorobenzoate (CAS 2137649-82-0) is a chemical compound with the molecular formula C8H4ClF3O4S and a molecular weight of 288.63 g/mol. IUPAC name: methyl 5-chlorosulfonyl-2,3,4-trifluorobenzoate. InChIKey: VPNCPEVPFPFWCX-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O4S |
|---|---|
| Molecular weight | 288.63 g/mol |
| IUPAC name | methyl 5-chlorosulfonyl-2,3,4-trifluorobenzoate |
| InChIKey | VPNCPEVPFPFWCX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1F)F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)