Products 2137649-82-0

CAS 2137649-82-0 is the registry number for Methyl 5-(chlorosulfonyl)-2,3,4-trifluorobenzoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 5-chlorosulfonyl-2,3,4-trifluorobenzoate (CAS 2137649-82-0) is a chemical compound with the molecular formula C8H4ClF3O4S and a molecular weight of 288.63 g/mol. IUPAC name: methyl 5-chlorosulfonyl-2,3,4-trifluorobenzoate. InChIKey: VPNCPEVPFPFWCX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4ClF3O4S
Molecular weight288.63 g/mol
IUPAC namemethyl 5-chlorosulfonyl-2,3,4-trifluorobenzoate
InChIKeyVPNCPEVPFPFWCX-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C(=C1F)F)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)