Products 2378554-12-0

CAS 2378554-12-0 is the registry number for 3-Chloro-5-((trifluoromethyl)sulfonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-chloro-5-(trifluoromethylsulfonyl)benzoic acid (CAS 2378554-12-0) is a chemical compound with the molecular formula C8H4ClF3O4S and a molecular weight of 288.63 g/mol. IUPAC name: 3-chloro-5-(trifluoromethylsulfonyl)benzoic acid. InChIKey: XIRNLBIOYCFJHO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4ClF3O4S
Molecular weight288.63 g/mol
IUPAC name3-chloro-5-(trifluoromethylsulfonyl)benzoic acid
InChIKeyXIRNLBIOYCFJHO-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1S(=O)(=O)C(F)(F)F)Cl)C(=O)O

Computed by PubChem (NCBI)