CAS 1423031-87-1 appears in our catalog under these names: 4-Amino-6-methoxy-1,2-dihydroquinolin-2-one hydrochloride, 95%, 4-Amino-6-methoxy-1,2-dihydroquinolin-2-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-amino-6-methoxy-1H-quinolin-2-one;hydrochloride (CAS 1423031-87-1) is a chemical compound with the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. IUPAC name: 4-amino-6-methoxy-1H-quinolin-2-one;hydrochloride. InChIKey: QKFIIANZKAZXPS-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O2 |
|---|---|
| Molecular weight | 226.66 g/mol |
| IUPAC name | 4-amino-6-methoxy-1H-quinolin-2-one;hydrochloride |
| InChIKey | QKFIIANZKAZXPS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=O)C=C2N.Cl |
Computed by PubChem (NCBI)