CAS 1423037-12-0 appears in our catalog under these names: 6-Aminohept-2-enedioic acid hydrochloride, 95%, 6-Aminohept-2-enedioic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(E)-6-aminohept-2-enedioic acid;hydrochloride (CAS 1423037-12-0) is a chemical compound with the molecular formula C7H12ClNO4 and a molecular weight of 209.63 g/mol. IUPAC name: (E)-6-aminohept-2-enedioic acid;hydrochloride. InChIKey: LMOJFGSDRKAURM-VEELZWTKSA-N.
| Molecular formula | C7H12ClNO4 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | (E)-6-aminohept-2-enedioic acid;hydrochloride |
| InChIKey | LMOJFGSDRKAURM-VEELZWTKSA-N |
| SMILES | C(CC(C(=O)O)N)/C=C/C(=O)O.Cl |
Computed by PubChem (NCBI)