CAS 2379651-40-6 is the registry number for Piperidine-2,3-dicarboxylic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Piperidine-2,3-dicarboxylic acid;hydrochloride (CAS 2379651-40-6) is a chemical compound with the molecular formula C7H12ClNO4 and a molecular weight of 209.63 g/mol. IUPAC name: piperidine-2,3-dicarboxylic acid;hydrochloride. InChIKey: NXLAIDOYPHVITO-UHFFFAOYSA-N.
| Molecular formula | C7H12ClNO4 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | piperidine-2,3-dicarboxylic acid;hydrochloride |
| InChIKey | NXLAIDOYPHVITO-UHFFFAOYSA-N |
| SMILES | C1CC(C(NC1)C(=O)O)C(=O)O.Cl |
Computed by PubChem (NCBI)