CAS 1461706-33-1 is the registry number for Piperidine-3,4-dicarboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Piperidine-3,4-dicarboxylic acid;hydrochloride (CAS 1461706-33-1) is a chemical compound with the molecular formula C7H12ClNO4 and a molecular weight of 209.63 g/mol. IUPAC name: piperidine-3,4-dicarboxylic acid;hydrochloride. InChIKey: SHNZVKXTIGONTP-UHFFFAOYSA-N.
| Molecular formula | C7H12ClNO4 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | piperidine-3,4-dicarboxylic acid;hydrochloride |
| InChIKey | SHNZVKXTIGONTP-UHFFFAOYSA-N |
| SMILES | C1CNCC(C1C(=O)O)C(=O)O.Cl |
Computed by PubChem (NCBI)