CAS 1423037-46-0 appears in our catalog under these names: 5-(4-Methyl-1-piperazinyl)-2-furaldehydeoxalate, 95%, 5-(4-Methylpiperazin-1-yl)furan-2-carbaldehyde oxalate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
5-(4-methylpiperazin-1-yl)furan-2-carbaldehyde;oxalic acid (CAS 1423037-46-0) is a chemical compound with the molecular formula C12H16N2O6 and a molecular weight of 284.26 g/mol. IUPAC name: 5-(4-methylpiperazin-1-yl)furan-2-carbaldehyde;oxalic acid. InChIKey: YHJLXRKLGGKWIT-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O6 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | 5-(4-methylpiperazin-1-yl)furan-2-carbaldehyde;oxalic acid |
| InChIKey | YHJLXRKLGGKWIT-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(O2)C=O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)