Products 1491152-23-8
CAS 1491152-23-8 appears in our catalog under these names: Mal–L–PA–NH–Boc, Mal-L-Dap(Boc)-OH, Mal-L-PA-NH-Boc 95%, (S)-3-((tert-Butoxycarbonyl)amino)-2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoic acid, 97%, 97%, Mal-L-PA-NH-Boc, 99.30%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 250mg, 500mg, 1g, 5g, 500 mg.
(2S)-2-(2,5-dioxopyrrol-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1491152-23-8) is a chemical compound with the molecular formula C12H16N2O6 and a molecular weight of 284.26 g/mol. IUPAC name: (2S)-2-(2,5-dioxopyrrol-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: QNSOCOXQLKMHCV-ZETCQYMHSA-N.
| Molecular formula | C12H16N2O6 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | (2S)-2-(2,5-dioxopyrrol-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | QNSOCOXQLKMHCV-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](C(=O)O)N1C(=O)C=CC1=O |
Computed by PubChem (NCBI)