Products 2382651-11-6
CAS 2382651-11-6 appears in our catalog under these names: (R)-3-((tert-Butoxycarbonyl)amino)-2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoic acid, >95%, >95%, Mal-D-Dap(Boc)-OH*DCHA. Offered by: Chemat, Iris Biotech. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g.
(2R)-2-(2,5-dioxopyrrol-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2382651-11-6) is a chemical compound with the molecular formula C12H16N2O6 and a molecular weight of 284.26 g/mol. IUPAC name: (2R)-2-(2,5-dioxopyrrol-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: QNSOCOXQLKMHCV-SSDOTTSWSA-N.
| Molecular formula | C12H16N2O6 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | (2R)-2-(2,5-dioxopyrrol-1-yl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | QNSOCOXQLKMHCV-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C(=O)O)N1C(=O)C=CC1=O |
Computed by PubChem (NCBI)