CAS 1423040-62-3 appears in our catalog under these names: (R)-1-(6-Methylpyridin-2-yl)ethan-1-amine dihydrochloride, 97%, (1R)-1-(6-Methylpyridin-2-yl)ethan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
(1R)-1-(6-methyl-2-pyridinyl)ethanamine;dihydrochloride (CAS 1423040-62-3) is a chemical compound with the molecular formula C8H14Cl2N2 and a molecular weight of 209.11 g/mol. IUPAC name: (1R)-1-(6-methyl-2-pyridinyl)ethanamine;dihydrochloride. InChIKey: ADHLSEZFNCMZFN-XCUBXKJBSA-N.
| Molecular formula | C8H14Cl2N2 |
|---|---|
| Molecular weight | 209.11 g/mol |
| IUPAC name | (1R)-1-(6-methyl-2-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | ADHLSEZFNCMZFN-XCUBXKJBSA-N |
| SMILES | CC1=NC(=CC=C1)[C@@H](C)N.Cl.Cl |
Computed by PubChem (NCBI)