CAS 1423123-94-7 appears in our catalog under these names: 1-Methyl-1H-1,2,3-triazole-4-boronic acid pinacol ester, 95%, 1-Methyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-1,2,3-triazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole (CAS 1423123-94-7) is a chemical compound with the molecular formula C9H16BN3O2 and a molecular weight of 209.06 g/mol. IUPAC name: 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole. InChIKey: JRZQTIYNOZRXEG-UHFFFAOYSA-N.
| Molecular formula | C9H16BN3O2 |
|---|---|
| Molecular weight | 209.06 g/mol |
| IUPAC name | 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole |
| InChIKey | JRZQTIYNOZRXEG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=N2)C |
Computed by PubChem (NCBI)