CAS 2186640-04-8 is the registry number for 1-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-1,2,4-triazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,4-triazole (CAS 2186640-04-8) is a chemical compound with the molecular formula C9H16BN3O2 and a molecular weight of 209.06 g/mol. IUPAC name: 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,4-triazole. InChIKey: BXOCMWFAGIOXMO-UHFFFAOYSA-N.
| Molecular formula | C9H16BN3O2 |
|---|---|
| Molecular weight | 209.06 g/mol |
| IUPAC name | 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,4-triazole |
| InChIKey | BXOCMWFAGIOXMO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC=NN2C |
Computed by PubChem (NCBI)