Products 2800894-84-0
CAS 2800894-84-0 is the registry number for 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-5-amine (CAS 2800894-84-0) is a chemical compound with the molecular formula C9H16BN3O2 and a molecular weight of 209.06 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-5-amine. InChIKey: DNUUJMDPVNHXAA-UHFFFAOYSA-N.
| Molecular formula | C9H16BN3O2 |
|---|---|
| Molecular weight | 209.06 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-5-amine |
| InChIKey | DNUUJMDPVNHXAA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(NN=C2)N |
Computed by PubChem (NCBI)